| L0107 |
Lactacystin |
200 µg |
$367.60 |
| |
C15H24N2O7S FW 376.4 [133343-34-7] |
|
|
| |
Proteasome inhibitor, induces apoptosis and inhibits angiogenesis. |
|
|
| |
Tomoda H, Omura S. Yakugaku Zasshi 120:935-49 (2000). |
|
|
| |
Wagenknecht B et al. J Neurochem 75:2288-97 (2000). |
|
|
| |
Kumeda SI et al. Anticancer Res 19:3961-8 (1999). |
|
|
| |
|
|
|
| L0109 |
Lactalbumin |
1 lb |
$16.90 |
| |
[9013-90-5] |
5 lb |
$59.50 |
| |
A non soluble denatured protein fraction from milk. Found to have antiproliferative |
|
|
| |
activity which is useful in the prevention of colon cancer and breast cancer. |
|
|
| |
Ganjam LS, Thornton WH Jr, Marshall RT, MacDonald RS. J Dairy Sci. 80:2325-9 (1997). |
|
|
| |
Biffi A, Coradini D, Larsen R et al. Nutr Cancer. 28:93-9 (1997). |
|
|
| |
|
|
|
| L0209 |
Lactoferrin (Bovine) |
10 mg |
$29.10 |
| |
Protein contents 96-98% |
50 mg |
$122.30 |
| |
An antimicrobial peptide, which has significant antimicrobial activity against |
100 mg |
$219.70 |
| |
Helicobacter species. It has antifungal activity. |
|
|
| |
Dial EJ, Hall LR, Serna H, Romero JJ et al. Dig Dis Sci. 43:2750-6 (1998). |
|
|
| |
Wakabayashi H, Uchida K, Yamauchi K et al. J Antimicrob Chemother. 46:595-602 (2000). |
|
|
| |
|
|
|
| L0211 |
Lactulose |
10 g |
$34.50 |
| |
C12H22O11 FW 342.30 [4618-18-2] |
25 g |
$54.10 |
| |
A keto analogue of lactose. In humans, lactulose reduced dehydroxylation of |
|
|
| |
chenodeoxycholic acid to the potentially toxic secondary bile acid lithocholic by over |
|
|
| |
90%. It is also a substrate for preferential growth of Bifidobacterium longum, a bacterium |
|
|
| |
which has been shown to afford protection against colon tumorigenesis. |
|
|
| |
Hennigan TW, Sian M, Matthews J, Allen-Mersh TG. Surg Oncol. 4:31-4 (1995). |
|
|
| |
Owen RW. Scand J Gasteroenterol. 222:76-82 (1977). |
|
|
| |
Challa A, Rao DR, Chawan CB, Shackel Ford L. Carcinogenesis. 18:517-21 (1997). |
|
|
| |
|
|
|
| L0226 |
Lagochiline |
25 mg |
$69.00 |
| |
C20H36O5 FW 356.50 |
100 mg |
$227.70 |
| |
A diterpene from the Turkestan Mint plant. It has hemostatic, hypotensive, and |
|
|
| |
sedative effects. |
|
|
| |
Schultes RE. Science. 163:245-54 (1969). |
|
|
| |
|
|
|
| L0248 |
Laminin peptide YIGSR |
1 mg |
$38.60 |
| |
Laminin fragment 929-933 |
5 mg |
$124.20 |
| |
|
|
|
| L0249 |
Laminin peptide YIGSR-NH2 |
1 mg |
$44.20 |
| |
|
5 mg |
$165.60 |
| |
|
|
|
| L0250 |
Laminin peptide SIKVAV |
1 mg |
$48.40 |
| |
|
5 mg |
$172.50 |
| |
|
|
|
| L0251 |
Laminin peptide CDPGYIGSR |
1 mg |
$89.70 |
| |
|
5 mg |
$345.00 |
| |
|
|
|
| L0349 |
Lamotrigine |
25 mg |
$50.40 |
| |
C9H7Cl2N5 FW 255.01 [ 84057-84-1] |
100 mg |
$162.40 |
| |
An anti-convulsant drug used to treat siezures, neuropathic pain and epilepsy. |
500 mg |
$504.00 |
| |
Backonja MM, Neurology. 59 (5 Suppl 2):S14-7 (2002). |
|
|
| |
Karceski S, Morrell MJ, Carpenter D. Epilepsy Behav. Suppl 1:S1-64; quiz S65-7 (2005). |
|
|
| |
|
|
|
| L0254 |
Lansoprazole |
250 mg |
$31.40 |
| |
C16H14F3N3O2S FW 369.36 [103577-45-3] |
1 g |
$87.80 |
| |
A proton pump inhibitor. It inhibits H+/K(+) ATPase, resulting in potent and long-lasting |
|
|
| |
inhibition of gastric acid secretion. It has also shown antibacterial activity against H. pylori. |
|
|
| |
Iwahi T, Satoh H, Nakao M et al. Antimicrob Agents Chemother. 35:490-6 (1991). |
|
|
| |
Nagaya H, Satoh H. Nippon Rinsho. 50:26-32 (1992). |
|
|
| |
Li XQ, Andersson TB, Ahlstrom M et al. Drug Metab Dispos. 32:821-7 (2004). |
|
|
| |
|
|
|
| L0360 |
Lapatinib Ditosylate |
10 mg |
$168.00 |
| |
C29H26ClFN4O4S.H2O.(C6H6O3S)2 FW 915.42 [388082-78-8] |
25 mg |
$268.80 |
| |
A treatment FDA approved for breast cancer. It is used in patients whose cancer is |
100 mg |
$784.00 |
| |
HER2 positive. Used for treatment of solidt tumors and is an ATP competitive |
|
|
| |
epidermal growth factor and HER2 dual tyrosine kinase inhibitor. |
|
|
| |
Feng, Yu-fei. Zhongguo Xinyao Zazhi (2007), 16(23), 1990-1993. |
|
|
| |
Nelson, M. H. Therapeutics and Clinical Risk Management (2007), 3(4), 665-673. |
|
|
| |
|
|
|
| L0060 |
Lappaconitine |
25 mg |
$75.90 |
| |
C32H44N2O8 FW 584.70 [32854-75-4]\ |
100 mg |
$227.70 |
| |
An alkaloid isolated from the root of Aconltitum sinomantanum Nakai has |
500 mg |
$758.90 |
| |
strong analgesic activity that does not involve the opioid receptor. It was shown to |
|
|
| |
have class-I antiarrhythmic action and irreversibly blocks cloned human heart |
|
|
| |
(hH1) channels by binding to the site 2 receptor. |
|
|
| |
Ono, M, Satoh T. Res Comm. Chem Path Pharm. 63:13-25 (1989). |
|
|
| |
Heubach JF, Schule A. Planta Medica 64:22-26 (1998). |
|
|
| |
Wright SN. Mol Pharm. 59:183-192 (2001). |
|
|
| |
|
|
|
| L0076 |
Latrunculin A |
1 mg |
$229.70 |
| |
C22H31NO5S FW 421.55 [76343-93-6] |
|
|
| |
It is an actin-binding marine toxin that distrupts microfilament-mediated processes. It inhibits |
|
|
| |
actin polymerisation in vitro and in vivo. |
|
|
| |
Coue, M.; Brenner, S.L.; Spector, I.; Korn E.D. FEBS letters. 213: 316-318 (1987). |
|
|
| |
Morton, W. M.; Ayscough, K.R.; McLaughlin, P.J. Nature Cell Biol. 2: 376-378 (2000). |
|
|
| |
Spector, I.; Shochet, N.R.; Kashman, Y.; Groweiss, A. Science 214: 493-495 (1983). |
|
|
| |
YarmolaEG;SomasundaramT;BoringTA; SpectorI; Bubb,M.R.J.Biol.Chem.275:28120-28127(2000) |
|
|
| |
|
|
|
| L0284 |
Lavendustin A |
1 mg |
$144.30 |
| |
C21H19NO6 FW 381.38 [125697-92-9] |
5 mg |
$508.30 |
| |
Protein tyrosine kinase inhibitor. Suppresses VEGF-induced angiogenesis. |
|
|
| |
Onoda T, Iinuma H, Sasaki Y et al. J Nat Prod. 52:1252-7 (1989). |
|
|
| |
Hu DE, Fan TP. Brit J Pharmacol. 114:262-8 (1995). |
|
|
| |
|
|
|
| L1817 |
Leflunomide |
100 mg |
$48.40 |
| |
C12H9F3N2O2 FW 270.2 [175706-12-6] |
500 mg |
$172.10 |
| |
An immunomodulator, inhibits tyrosine phosphorylation and pyrimidine |
1 g |
$301.40 |
| |
nucleotide synthesis. |
|
|
| |
Xu X, Shen J, Mall JW et al. Biochem Pharmacol. 58:1405-13 (1999). |
|
|
| |
Manna SK, Mukhopadhyay A, Aggarwal BB. J Immunol. 165:5962-9 (2000). |
|
|
| |
|
|
|
| L1628 |
Ac-LEHD-PNA |
1 mg |
$46.60 |
| |
C29H38N8O11 FW 674.7 |
2 mg |
$78.80 |
| |
|
5 mg |
$138.00 |
| |
|
|
|
| L1660 |
Leptin (22-56), human |
1 mg |
$421.60 |
| |
OBGRP(22-56), human |
|
|
| |
C171H298N50O56 FW 3950.6 |
|
|
| |
|
|
|
| L1661 |
Leptin (116-130), mouse |
0.5 mg |
$107.50 |
| |
C64H107N18O25S1 FW 1560.74 |
1 mg |
$182.80 |
| |
Significantly reduces weight gain by injected female C57BL/6J ob/ob mice. |
2.5 mg |
$322.60 |
| |
Grasso P, Leinung MC, Ingher SP, Lee DW. Endocrinology. 138:1413-1418 (1997). |
|
|
| |
|
|
|
| L1761 |
Leptomycin B |
1 µg |
$102.90 |
| |
C33H48O6 FW 540.73 [87081-35-4] |
5 µg |
$363.80 |
| |
An antifungal antibiotic, found to be a potent antitumor agent. It is suggested that the antitumor |
|
|
| |
effect is related to cytochrome c release, activation of caspases, and selective down-regulation of |
|
|
| |
Mc1-1 and XIAP. Leptomycin B has also been found to inactivate the export receptor CRM1. |
|
|
| |
Sasaki H, Yoshida M, Beppu T. Radiat Res. 129:163-70 (1992). |
|
|
| |
Jang BC, Paik JH, Jeong HY et al. Biochem Pharmacol. 68:263-74 (2004). |
|
|
| |
Meissner T, Krause E, Vinkemeier U. FEBS Lett. 576:27-30 (2004). |
|
|
| |
|
|
|
| L1878 |
Letrozole |
25 mg |
$62.20 |
| |
C17H11N5 FW 285.30 [112809-51-5] |
50 mg |
$103.50 |
| |
A non-steroidal antiaromatase used in the treatment of advanced breast cancer |
100 mg |
$172.50 |
| |
and chemoprevention. |
|
|
| |
Ingle JN. Oncology (Huntingt). 15:28-34 (2001). |
|
|
| |
Bhatnagar AS, Hausler A, Schieweck K et al. J Steroid Biochem Mol Biol. 37:1021-7 (1990). |
|
|
| |
Brodie AM. J Steroid Biochem Mol Biol. 49:281-7 (1994). |
|
|
| |
|
|
|
| L1980 |
Leucokinin I |
1 mg |
$35.80 |
| |
C41H52N11O12 FW 891.93 |
2 mg |
$60.90 |
| |
A neuropeptide that was originally isolated from the cockroach Leucophaea |
5 mg |
$107.50 |
| |
maderae. |
|
|
| |
Lee BH, Kang H, Kwon D et al. Tissue Cell. 30:74-85 (1998). |
|
|
| |
|
|
|
| L1981 |
Leucokinin VIII |
1 mg |
$35.80 |
| |
C42H52N10O11 FW 872.94 |
2 mg |
$60.90 |
| |
|
5 mg |
$107.50 |
| |
|
|
|
| L1983 |
Leucomyosuppressin (lms) |
0.5 mg |
$28.70 |
| |
C59H84N16O15 FW 1257.44 |
1 mg |
$48.40 |
| |
An insect myoinhibitory neuropeptide that has been shown to inhibit |
2.5 mg |
$86.00 |
| |
contraction of both visceral and skeletal muscles of insects and may also be associated |
|
|
| |
with feeding and digestion. |
|
|
| |
Fuse M, Bendena WG, Donly BC et al. J Comp Neurol. 395:328-341 (1998). |
|
|
| |
Meola SM, Wright MS, Holman GM, Thompson JM. J Med Entomol. 28:712-718 (1991). |
|
|
| |
|
|
|
| |
Leucovorin Calcium (See calcium folinate, pentahydrate) |
|
|
| |
|
|
|
| L1881 |
Leuprolide Acetate Salt |
1 mg |
$57.80 |
| |
C59H84N16O12 FW 1209.4 [74381-53-6] |
5 mg |
$200.40 |
| |
A gonadotropin inhibitor that decreases testosterone levels in men and estrogen levels in |
|
|
| |
women. Implantable leuprolide delivery system provides suppression of testosterone in |
|
|
| |
patients with advanced prostate cancer. In experimental animals it was found to inhibit |
|
|
| |
chemically induced mammary tumor formation as effectively as surgical ophorectomy. |
|
|
| |
Fowler JE, Gottesman JE, Reid CF et al. J Urol. 164:730-4 (2000). |
|
|
| |
Jett EA, Lerner Mr, Light foot SA et al. Breast Cancer Res Treat. 58:131-6 (1999). |
|
|
| |
|
|
|
| L1882 |
Leuprorelin Acetate |
Please inquire |
|
| |
C59H84N16O12 FW 1209.43 [53714-56-0] |
|
|
| |
Leuprorelin acetate is a potent LHRH agonist. Used for the treatment of advanced hormone- |
|
|
| |
dependent prostate cancer, endometriosis, advanced hormone-dependent breast cancer |
|
|
| |
and central precocious puberty. |
|
|
| |
|
|
|
| L1682 |
Levamisole Hydrochloride |
5 g |
$30.90 |
| |
C11H12N2S.HCl FW 240.76 [16595-80-5] |
10 g |
$51.60 |
| |
An anti-neoplastic, immuno-modulating agent that is used as an adjuvant in colon cancer therapy. |
|
|
| |
It selectively induces apoptosis and growth arrest in cultured human micro-and macro vascular |
|
|
| |
endothelial cells. In experimental animals, levamisole reduces both the number and size of |
|
|
| |
tumors in the colon and buccal pouch. |
|
|
| |
Artwohl M, Holzenbein T, Wagner et al. BR J Pharmacol. 131:1577-1583 (2000). |
|
|
| |
Suzuki H, Yamamoto J, Iwata Y et al. Jpn J Surg. 16:152-5 (1986). |
|
|
| |
Eisenberg E, Shakilar G. Oral Surg Oral Pathol. 43:562-71 (1997). |
|
|
| |
|
|
|
| L1784 |
Levetiracetam |
100 mg |
$39.20 |
| |
C8H14N2O2 FW 170.21 [102767-28-2] |
250 mg |
$72.80 |
| |
An anticonvulsant drug used to treat epilepsy. Binds to a synaptic vesicle |
1 g |
$201.60 |
| |
protein SV2A which may lead to impeded nerve connection. |
|
|
| |
Lee, Jong Woo. New England Journal of Medicine (2008), 359(17), 1853. |
|
|
| |
|
|
|
| L1735 |
Levitide |
1 mg |
$35.80 |
| |
C66H119N21O19S FW 1542.88 |
2 mg |
$60.90 |
| |
Originally isolated from skin secretions of the SouthAfrican frog Xenopus laevis. |
5 mg |
$107.50 |
| |
Poulter L, Terry AS, Williams DH et al. J Biol Chem. 263:3279-3283 (1988). |
|
|
| |
|
|
|
| L1780 |
Levocetirizine Dihydrochloride |
1 g |
$31.40 |
| |
C21H25ClN2O3.2HCl FW 461.81 [83881-52-1] |
5 g |
$65.30 |
| |
The active R-enantiomer of cetirizine. It is a selective H1 receptor antagonist |
25 g |
$250.90 |
| |
with potential anti-inflammatory effects. |
|
|
| |
Thomson L, Blaylock MG, Sexton DW et al. Clin Exp Allergy. 32:1187-92 (2002). |
|
|
| |
Day JH, Eliis AK, Rafeiro E. Med Actual. 40:415-21 (2004). |
|
|
| |
|
|
|
| L1782 |
Levodopa |
1 g |
$27.70 |
| |
C9H11NO4 FW 197.19 [59-92-7] |
5 g |
$52.50 |
| |
The natural form of DOPA used in the treatment of Parkinson's disease. |
10 g |
$82.90 |
| |
Morris JG. Clin Exp Neurol. 15:24-50 (1978). |
|
|
| |
|
|
|
| L1786 |
Levofloxacin Hydrochloride |
500 mg |
$48.40 |
| |
C18H20FN3O4.HCl.H2O FW 415.84 |
1 g |
$77.60 |
| |
The optical S-(-) isomer of the fluoroquinolone antibacterial, ofloxacin. It |
5 g |
$318.50 |
| |
has twice the potency of ofloxacin. |
|
|
| |
Davis R, Bryson HM. Drugs 47:677-700 (1994). |
|
|
| |
|
|
|
| L1684 |
Levonorgestrel |
100 mg |
$36.10 |
| |
D(-)Norgestrel |
500 mg |
$152.20 |
| |
C21H28O2 FW 312.45 m.p. 235-2370C [797-63-7] |
1 g |
$295.50 |
| |
A synthetic progestin that binds to progesterone and androgen receptors but not the |
|
|
| |
estrogen receptor. It induces apoptosis in ovarian epithelium cells. |
|
|
| |
Lemus AE, Vilchis F, Damsky R. J Steroid Biochem Mol Biol. 41:881-90 (1992). |
|
|
| |
Rodriguez GC, Walmer DK, Cline M et al. J Soc Gynecol Investig. 5:271-6 (1998). |
|
|
| |
|
|
|
| L1884 |
Levosimendan |
100 mg |
$65.30 |
| |
C14H12N6O FW 280.28 [141505-33-1] |
250 mg |
$119.20 |
| |
A Ca(2+) sensitizer that increases contractile force of the myocardium by |
1 g |
$376.30 |
| |
enhancing the sensitivity of myofilaments to calcium without increasing intracellular |
|
|
| |
calcium concentration. It has been shown to reduce circulating proinflammatory |
|
|
| |
cytokine interleukin-6 and soluble apoptosis mediators. |
|
|
| |
Udvary E, Papp JG, Vegh A. Br J Pharmacol. 114:656-61 (1995). |
|
|
| |
Parissis JT, Adamopoulos S, Antoniades C et al. Am J Cardiol. 93:1309-12 (2004). |
|
|
| |
Eriksson O, Pollesello P, Haikala H. J Cardiovasc Pharmacol. 44:316-21 (2004). |
|
|
| |
|
|
|
| |
levothyroxine sodium (See L-thyroxine sodium salt pentahydrate) |
|
|
| |
|
|
|
| L3250 |
D-Limonene |
500 ml |
$43.50 |
| |
C10H16 FW 136.23 [5989-27-5] |
|
|
| |
A monoterpene found to prevent mammary cancer by inducing hepatic glutathione-S- |
|
|
| |
transferase and uridine diphosphoglucuronosyl transferase. It inhibits isoprenylation |
|
|
| |
of small G-proteins. |
|
|
| |
Elegbede JA, Maltzman TH, Elson CE, Gould MN. Carcinogenesis. 14:1221-1223 (1993). |
|
|
| |
Gould MN. Environ Health Perspect. 105:977-979 (1997). |
|
|
| |
|
|
|
| L3550 |
Limonin |
50 mg |
$54.70 |
| |
Evodine |
100 mg |
$94.60 |
| |
C26H30O80 FW 470.52 m.p. 298-3000C [1180-71-8] |
500 mg |
$311.40 |
| |
Natural product isolated from grapefruit seed. It is one of the bitter principles of citrus. |
|
|
| |
It was found to inhibit chemically induced carcinogenesis. It also possesses antifeedant properties. |
|
|
| |
Rouseff RL, J Agric. Food Chem. 30:504-507 (1982). |
|
|
| |
Maier VP, Hasegawa S. Bennett RD et al. Protect Ecol. 6:91(1984). |
|
|
| |
|
|
|
| L3551 |
Limonin Glucoside |
1 mg |
$86.10 |
| |
Limonin 17 b-D-glucopyranoside |
5 mg |
$301.40 |
| |
C32H42O14 FW 650.67 |
|
|
| |
Natural product present in grape fruit and orange juices. Found to inhibit chemical |
|
|
| |
carcinogenesis. |
|
|
| |
Miller EG, Gonzales-Sanders AP, Couvillon AM et al. Nutr Cancer 17:1-7 (1992). |
|
|
| |
|
|
|
| L3454 |
Lincomycin Hydrochloride |
1 g |
$33.20 |
| |
C18H34N2O6S.HCl.H2O FW 443.00 [7179-49-9] |
5 g |
$138.00 |
| |
A macrolide antibiotic that is bacterostatic against staphylococcus aureus. It |
25 g |
$524.40 |
| |
inhibits protein synthesis by first binding to the ribosome in competition with |
|
|
| |
aminoacyl-tRNA. Subsequent interference continues to affect the binding of the |
|
|
| |
isomerized ribosome-aminoacyl-tRNA complex. |
|
|
| |
Heman-Ackah SM. J Pharm Sci. 64:1621-6 (1975). |
|
|
| |
Kallia-Raftopoulos S, Kalpaxis DL, Coutsogeorgopoulos C. Arch Biochem Biophys. 298:332-9 (1992). |
|
|
| |
|
|
|
| L3561 |
D,L-a-Lipoic acid |
1 g |
$18.00 |
| |
D,L-Thioctic acid |
5 g |
$52.50 |
| |
C8H14O2S2 FW 206.32 m.p. 58-620C [1077-28-7] |
25 g |
$223.40 |
| |
An antioxidant, inhibits protein oxidative modification of human low density lipoprotein. |
|
|
| |
Matsugo, Yan LJ, Konishi T et al. Biochem Biophys Res Commun. 243:819-824 (1997). |
|
|
| |
|
|
|
| L3362 |
b-Lipotropin (61-64) |
5 mg |
$35.80 |
| |
C22H26N4O6 FW 442.48 |
10 mg |
$60.90 |
| |
|
25 mg |
$107.50 |
| |
|
|
|
| L3374 |
Lisinopril |
100 mg |
$30.50 |
| |
C21H31N3O5.2H2O FW 441.52 [83915-83-7] |
1 g |
$68.40 |
| |
An angiotensin-converting enzyme inhibitor. It blocks AT1a-receptor signaling |
5 g |
$250.50 |
| |
which may inhibit angiogenesis, growth and metastasis of tumors. |
|
|
| |
Goa KL, Balfour JA, Zuanetti G. Drugs 52:564-588 (1996). |
|
|
| |
Fujita M, Hayashi I, Yamashina S. Biochem Biophys Res Comm. 294:441-447 (2002). |
|
|
| |
|
|
|
| L3577 |
Litorin |
1 mg |
$43.00 |
| |
C51H68N14O11S FW 1085.28 |
2 mg |
$73.50 |
| |
A bombesin-like neuropeptide that may be involved in the physiological |
5 mg |
$129.00 |
| |
regulation of thermal homeostasis. |
|
|
| |
Esakov AI, Ashmarin IP, Serova ON et al. Biomed Sci. 1:610-612 (1990). |
|
|
| |
Tartara A, Bo P, Savoldi F. Peptides. 3:125-127 (1982). |
|
|
| |
|
|
|
| L5822 |
Lofexidine Hydrochloride |
1 g |
$48.40 |
| |
C11H12Cl2N2O FW 259.60 [21498-08-8] |
5 g |
$207.00 |
| |
It is an a2-adrenergic agonist useful in the management of opioid drawer. |
25 g |
$758.90 |
| |
TimmermansPB,van Kemenade JE, Harms YM et al.Arch Int Pharmacodyn Ther.261:23-35 (1983). |
|
|
| |
Brown AS, Fleming PM. J Psychopharmacol. 12:93-6 (1998). |
|
|
| |
|
|
|
| L5749 |
Lomefloxacin Hydrochloride |
1 g |
$23.30 |
| |
C17H19F2N3O3.HCl FW 387.81 [98079-52-8] |
5 g |
$82.50 |
| |
A fluoroquinolone antibiotic that inhibis DNA gyrase. |
10 g |
$129.20 |
| |
Piddock LJ, Hall MC, Wise R. Antimicrob Agents Chemother. 34:1088-93 (1990). |
|
|
| |
|
|
|
| L5751 |
Lomerizine Hydrochloride |
500 mg |
$69.00 |
| |
C27H30F2N2O3.2HCl FW 541.47 [101477-54-7] |
1 g |
$110.40 |
| |
A Ca2+ channel blocker used as an anti-migraine agent. |
5 g |
$476.10 |
| |
HaraH,ShimazawaM,Hashimoto M,Sukamoto T.Nippon Yakurigaku Zasshi.112:138P-142P(1998). |
|
|
| |
|
|
|
| L5648 |
Lomustine |
50 mg |
$44.90 |
| |
CCNU |
100 mg |
$80.60 |
| |
C9H16ClN3O2 FW 233.7 |
500 mg |
$322.30 |
| |
Posseses antitumor activity similar to carmustine. |
|
|
| |
Marshall ES, Holdaway KM, Shaw JH et al. Oncol Res 5:301-9 (1993). |
|
|
| |
|
|
|
| L5658 |
Lonidamine |
5 mg |
$50.20 |
| |
C15H10Cl2N2O2 FW 321.16 [50264-69-2] |
25 mg |
$225.80 |
| |
A mitochondria-targeting antitumor agent. It has been shown to induce apoptosis |
100 mg |
$627.20 |
| |
in certain cells, and potentiate cisplatin and paclitaxel activity. |
|
|
| |
Orlandi L, Zaffaroni N, Bearzatto A et al. Int J Cancer. 78:377-84 (1998). |
|
|
| |
De Lena M, Lorusso V, Latorre A et al. Eur J Cancer. 37:364-8 (2001). |
|
|
| |
Miyato Y, Ando K. J Radiat Res (Tokyo). 45:189-94 (2004). |
|
|
| |
|
|
|
| L5660 |
Loperamide Hydrochloride |
5 g |
$69.00 |
| |
C29H33ClN2O2.HCl FW 513.51 [34552-83-5] |
25 g |
$276.00 |
| |
A mu-opioid agonist that is an antidiarrhoeal drug which inhibits intestinal motility and |
|
|
| |
secretion. It has been shown to suppress the calcium-influx in dorsal root ganglion neurons. |
|
|
| |
Hagiwara K, Nakagawasai O, Murata A et al. Neurosci Res. 46:493-7 (2003). |
|
|
| |
Klaren PH, Giesberts AN, Chapman J et al. J Pharm Pharmacol. 52:679-86 (2000). |
|
|
| |
|
|
|
| L5767 |
Loratadine |
500 mg |
$34.50 |
| |
C22H23ClN2O2 FW 382.88 [79794-75-5] |
1 g |
$52.50 |
| |
A non sedative antihistamine, inhibits histamine-induced activities of IL-6 and |
5 g |
$207.00 |
| |
IL-8 secretion in endothelial cells. |
|
|
| |
Roman IJ, Danzig MR. Clin Rev Allergy. 11:89-110 (1993). |
|
|
| |
Molet S, Gosset P, Lassalle P et al. Clin Exp Allergy. 27:1167-74 (1997). |
|
|
| |
|
|
|
| L5769 |
Lorglumide Sodium |
25 mg |
$75.90 |
| |
C22H31Cl2N2O4Na FW 481.39 [97964-56-2] |
100 mg |
$274.30 |
| |
A specific cholecytokinin receptor antagonist. It inhibits the effects of cholecytokinin on |
|
|
| |
pancreatic growth and the development of pancreatic lesions and chemically induced |
|
|
| |
carcinogenesis of the pancreas in rats. |
|
|
| |
Meijers M, Appel MJ et al. Carcinogenesis. 13:1525-8 (1992). |
|
|
| |
Watanapa P, Flaks B, Oztas Het al. J Cancer. 67:663-7 (1993). |
|
|
| |
Sperti C, Militello C et al. J Surg Oncol. 57:11-6 (1994). |
|
|
| |
|
|
|
| L5873 |
Losartan Potassium |
1 g |
$27.70 |
| |
C22H22ClKN6O FW 461.01 [124750-99-8] |
5 g |
$89.70 |
| |
An angiotensin II subtype I (AT1) receptor antagonist used for the treatment |
25 g |
$289.90 |
| |
of hypertension. It inhibits platelet activity by suppressing thrombin- |
|
|
| |
induced calcium transients and thromboxane release. |
|
|
| |
McIntyre M, Caffe SE, Michalak RA, Reid JL. Pharmacol Ther 74:181-94 (1997). |
|
|
| |
Schwemmer M, Sommer O, Bassenge E. Cardiovasc Drugs Ther. 15:301-7 (2001). |
|
|
| |
|
|
|
| |
Lovastatin (See Mevinolin) |
|
|
| |
|
|
|
| L5993 |
Loxoprofen |
100 mg |
$50.40 |
| |
C15H18O3 FW 246.3 [68767-14-6] |
250 mg |
$84.00 |
| |
A non-steroidal anti-inflammatory drug. Quickly converted to the trans-alcohol |
1 g |
$168.00 |
| |
metabolite. Similar to ibuprofen and naproxen. Cycloxygenase inhibitor. |
|
|
| |
Matsumoto M. Neuroscience letters (2006), 397(3), 249-53. |
|
|
| |
|
|
|
| L8248 |
Lumaricoxib |
100 mg |
$72.80 |
| |
C15H13CLFNO2 FW 293.72 [220991-20-8] |
250 mg |
$140.00 |
| |
Is a Cox-2 selective inhibitor NSAID. A member of the arylalkanoic acid family |
1 g |
$425.60 |
| |
of NSAIDs it binds to a separate site than the other Cox-2 inhibitors. Concerns |
|
|
| |
that it may cause liver failure prompted withdraw from the market. |
|
|
| |
Fox, A. Pain (2004), 107(1-2), 33-40 |
|
|
| |
|
|
|
| L8262 |
Lupinine |
25 mg |
$48.40 |
| |
C10H19NO FW 169.26 [486-70-4] |
100 mg |
$158.70 |
| |
An alkaloid isolate from Anabisis aphylla can reduce the effect of ethanol anesthesia. |
|
|
| |
Mirzaev S. Farmakol Toksikol. 41:52-5 (1978). |
|
|
| |
|
|
|
| L8276 |
Luteinizing Hormone Releasing Hormone |
1 mg |
$35.80 |
| |
LHRH |
2 mg |
$60.90 |
| |
C55H76N17O13 FW 1182.3 [9034-40-6] |
5 mg |
$107.50 |
| |
A decapeptide found to inhibit ovulation in the rat. |
|
|
| |
Rivier JE, Vale WW. Life Sci. 23:869-876 (1978). |
|
|
| |
|
|
|
| L8277 |
[Gln8] LH-RH, chicken |
1 mg |
$35.80 |
| |
C54H71N15O14 FW 1154.28 |
2 mg |
$60.90 |
| |
|
5 mg |
$107.50 |
| |
|
|
|
| L8278 |
LH-RH, salmon |
1 mg |
$35.80 |
| |
C60H73N15O13 FW 1212.36 |
2 mg |
$60.90 |
| |
|
5 mg |
$107.50 |
| |
|
|
|
| L2876 |
Luteinizing Hormone Releasing Hormone-III, |
1 mg |
$35.80 |
| |
Lamprey |
|
|
| |
LHRH-III, lamprey |
2 mg |
$60.90 |
| |
C59H75N18O14 FW 1259.4 |
5 mg |
$107.50 |
| |
|
|
|
| L8377 |
Luteolin |
100 mg |
$55.20 |
| |
C15H10O6 FW 286.24 [491-70-3] |
500 mg |
$172.50 |
| |
A flavonoid isolated from the fruit of Vitex rotundifolia. It is an |
1 g |
$241.50 |
| |
apoptosis inducer with anti-proliferative effects. |
|
|
| |
Molnar J, Beladi I, Domonkos K et al. Neoplasma 28:11-8 (1981). |
|
|
| |
Yee SB, Lee JH, Chung HY et al. Arch Pharm Res. 26:151-6 (2003). |
|
|
| |
|
|
|
| L9609 |
Lycopene |
1 mg |
$128.90 |
| |
C40H56 FW 536.87 m.p. 172-1730C [502-65-8] |
5 mg |
$428.70 |
| |
A carotenoid present in ripe fruits, particularly tomatoes. It is an antioxidant that |
|
|
| |
appears to have cancer chemopreventive properties, and helps AIDS patients. |
|
|
| |
Rousseau EJ, Davison AJ, Dunn B. Free Radic Biol Med. 13: 407-433 (1992). |
|
|
| |
Khachik F, Beecher GR, Smith JC Jr. J Cell Biochem Suppl. 22:236-246 (1995). |
|
|
| |
Periquet BA, Jammes NM et al. AIDS. 9:887-893 (1995). |
|
|
| |
|
|
|
| L9752 |
Lyngbyatoxin |
500 µg |
$2,604.00 |
| |
C27H39N3O2 FW 437.62 [70497-14-2] |
|
|
| |
A tumor promoter isolated from the marine blue-green algae Lyngbua majuscula. |
|
|
| |
It activates protein kinase C. |
|
|
| |
Fujiki H, Suganuma M, Hakii H et al. J Cancer Res Clin Oncol. 108:174-6 (1984). |
|
|
| |
Basu A, Kozikowski AP, Sato K, Lazo JS. Cancer Res. 51:2511-4 (1991). |
|
|
| |
|
|
|
| L9875 |
Lys(Boc)-Leu-Lys(Boc)-Obzl |
1 g |
$896.00 |
| |
C35H59N5O8 FW 667.9 |
|
|
| |
|
|
|
| |
|
|
|
| L9874 |
L-(+)Lysine Monohydrate |
5 g |
$26.00 |
| |
C6H14N2O2.XH2O FW 146.19 [39665-12-8] |
25 g |
$51.60 |
| |
|
100 g |
$168.70 |
| |
|
|
|
| L9880 |
Lysipressin Acetate |
Please inquire |
|
| |
C46H65N13O12S2 FW 1056.22 [50-57-7} |
|
|
| |
|
|
|
